VOA: N-(6-chloropyridin-3-yl)-N~2~-(1,4-dihydro-2H-pyrano[3,4-c]quinolin-9-yl)-L-alaninamide
VOA is a Ligand Of Interest in 9AUY designated by the Author
| Best-fitted instance in this entry |
| Other instances in this entry |
| Best-fitted instance in this entry |
| Best-fitted PDB instances with different target (top 5) |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
| 9AUY_VOA_A_802 | 65% | 35% | 0.101 | 0.904 | 0.8 | 1.62 | - | 7 | 0 | 0 | 100% | 1 |
| 9DC8_VOA_A_802 | 99% | 38% | 0.039 | 0.987 | 0.66 | 1.62 | - | 8 | 0 | 0 | 100% | 1 |
| 9AUV_VOA_A_802 | 99% | 37% | 0.043 | 0.984 | 0.61 | 1.71 | - | 7 | 0 | 0 | 100% | 1 |
| 9AV1_VOA_A_802 | 88% | 34% | 0.076 | 0.955 | 0.85 | 1.64 | - | 6 | 0 | 0 | 100% | 1 |