1KS
4-fluoro-N-methyl-N-{1-[4-(1-methyl-1H-pyrazol-5-yl)phthalazin-1-yl]piperidin-4-yl}-2-(trifluoromethyl)benzamide
Find entries where: 1KS
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 4-fluoro-N-methyl-N-{1-[4-(1-methyl-1H-pyrazol-5-yl)phthalazin-1-yl]piperidin-4-yl}-2-(trifluoromethyl)benzamide |
| Identifiers | 4-fluoranyl-N-methyl-N-[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| Formula | C26 H24 F4 N6 O |
| Molecular Weight | 512.502 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cn1c(ccn1)c2c3ccccc3c(nn2)N4CCC(CC4)N(C)C(=O)c5ccc(cc5C(F)(F)F)F |
| InChI | InChI=1S/C26H24F4N6O/c1-34(25(37)20-8-7-16(27)15-21(20)26(28,29)30)17-10-13-36(14-11-17)24-19-6-4-3-5-18(19)23(32-33-24)22-9-12-31-35(22)2/h3-9,12,15,17H,10-11,13-14H2,1-2H3 |
| InChIKey | SZBGQDXLNMELTB-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 61 |
| Chiral Atom Count | 0 |
| Bond Count | 65 |
| Aromatic Bond Count | 22 |
Drug Info: DrugBank
| DrugBank ID | DB12550 |
|---|---|
| Name | Taladegib |
| Groups | investigational |
| Description | Taladegib has been used in trials studying the treatment of Solid Tumor, COLON CANCER, BREAST CANCER, Advanced Cancer, and Rhabdomyosarcoma, among others. |
| Synonyms | Taladegib |
| Categories | Pyridazines |
| CAS number | 1258861-20-9 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2142592 |
| PubChem | 49848070 |
| ChEMBL | CHEMBL2142592 |
