32D
(1S)-1-[2-(difluoromethyl)pyridin-4-yl]-4-fluoro-1-(3-pyrimidin-5-ylphenyl)-1H-isoindol-3-amine
Find entries where: 32D
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (1S)-1-[2-(difluoromethyl)pyridin-4-yl]-4-fluoro-1-(3-pyrimidin-5-ylphenyl)-1H-isoindol-3-amine |
| Identifiers | (3S)-3-[2-[bis(fluoranyl)methyl]pyridin-4-yl]-7-fluoranyl-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine |
| Formula | C24 H16 F3 N5 |
| Molecular Weight | 431.413 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cc(cc(c1)[C@@]2(c3cccc(c3C(=N2)N)F)c4ccnc(c4)C(F)F)c5cncnc5 |
| InChI | InChI=1S/C24H16F3N5/c25-19-6-2-5-18-21(19)23(28)32-24(18,17-7-8-31-20(10-17)22(26)27)16-4-1-3-14(9-16)15-11-29-13-30-12-15/h1-13,22H,(H2,28,32)/t24-/m0/s1 |
| InChIKey | MRXBCEQZNKUUIP-DEOSSOPVSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 48 |
| Chiral Atom Count | 1 |
| Bond Count | 52 |
| Aromatic Bond Count | 24 |
Drug Info: DrugBank
| DrugBank ID | DB12368 |
|---|---|
| Name | AZD-3839 |
| Groups | investigational |
| Description | AZD3839 has been used in trials studying the basic science of Safety, Tolerability, Alzheimer's Disease, and Blood Concentration. |
| Synonyms | AZD-3839 |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 1227163-84-9 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2177913 |
| PubChem | 46202416 |
| ChEMBL | CHEMBL2177913 |
