3N1
(5-chloro-3-methyl-1-benzothiophen-2-yl)acetic acid
| Created: | 2010-05-19 |
| Last modified: | 2011-06-04 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 24 |
| Chiral Atom Count | 0 |
| Bond Count | 25 |
| Aromatic Bond Count | 10 |
Chemical Component Summary | |
|---|---|
| Name | (5-chloro-3-methyl-1-benzothiophen-2-yl)acetic acid |
| Systematic Name (OpenEye OEToolkits) | 2-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanoic acid |
| Formula | C11 H9 Cl O2 S |
| Molecular Weight | 240.706 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=C(O)Cc2sc1ccc(Cl)cc1c2C |
| SMILES | CACTVS | 3.370 | Cc1c(CC(O)=O)sc2ccc(Cl)cc12 |
| SMILES | OpenEye OEToolkits | 1.7.0 | Cc1c2cc(ccc2sc1CC(=O)O)Cl |
| Canonical SMILES | CACTVS | 3.370 | Cc1c(CC(O)=O)sc2ccc(Cl)cc12 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.0 | Cc1c2cc(ccc2sc1CC(=O)O)Cl |
| InChI | InChI | 1.03 | InChI=1S/C11H9ClO2S/c1-6-8-4-7(12)2-3-9(8)15-10(6)5-11(13)14/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | InChI | 1.03 | QNJIHQOPIPJYLU-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB21045 |
|---|---|
| Name | Tianafac |
| Groups | experimental |
| Description | Tianafac is a small molecule drug. The usage of the INN stem '-ac' in the name indicates that Tianafac is a anti-inflammatory agent, ibufenac derivative. Tianafac has a monoisotopic molecular weight of 240.0 Da. |
| Synonyms | Tianafac |
| Categories | Sulfur Compounds |
| CAS number | 51527-19-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 68686 |
| ChEMBL | CHEMBL1230158 |














