6VU
1-(4-methoxybutyl)-~{N}-(2-methylpropyl)-~{N}-[(3~{S},5~{R})-5-morpholin-4-ylcarbonylpiperidin-3-yl]benzimidazole-2-carboxamide
| Created: | 2016-07-06 |
| Last modified: | 2017-07-05 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 77 |
| Chiral Atom Count | 2 |
| Bond Count | 80 |
| Aromatic Bond Count | 10 |
Chemical Component Summary | |
|---|---|
| Name | 1-(4-methoxybutyl)-~{N}-(2-methylpropyl)-~{N}-[(3~{S},5~{R})-5-morpholin-4-ylcarbonylpiperidin-3-yl]benzimidazole-2-carboxamide |
| Systematic Name (OpenEye OEToolkits) | 1-(4-methoxybutyl)-~{N}-(2-methylpropyl)-~{N}-[(3~{S},5~{R})-5-morpholin-4-ylcarbonylpiperidin-3-yl]benzimidazole-2-carboxamide |
| Formula | C27 H41 N5 O4 |
| Molecular Weight | 499.646 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | COCCCCn1c2ccccc2nc1C(=O)N(CC(C)C)[CH]3CNC[CH](C3)C(=O)N4CCOCC4 |
| SMILES | OpenEye OEToolkits | 2.0.5 | CC(C)CN(C1CC(CNC1)C(=O)N2CCOCC2)C(=O)c3nc4ccccc4n3CCCCOC |
| Canonical SMILES | CACTVS | 3.385 | COCCCCn1c2ccccc2nc1C(=O)N(CC(C)C)[C@@H]3CNC[C@@H](C3)C(=O)N4CCOCC4 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.5 | CC(C)CN([C@H]1C[C@H](CNC1)C(=O)N2CCOCC2)C(=O)c3nc4ccccc4n3CCCCOC |
| InChI | InChI | 1.03 | InChI=1S/C27H41N5O4/c1-20(2)19-32(22-16-21(17-28-18-22)26(33)30-11-14-36-15-12-30)27(34)25-29-23-8-4-5-9-24(23)31(25)10-6-7-13-35-3/h4-5,8-9,20-22,28H,6-7,10-19H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | InChI | 1.03 | RHIBAIKQWJNESW-YADHBBJMSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB19464 |
|---|---|
| Name | Imarikiren |
| Groups | experimental |
| Description | Imarikiren is a small molecule drug. The usage of the INN stem '-kiren' in the name indicates that Imarikiren is a renin inhibitor. Imarikiren has a monoisotopic molecular weight of 499.32 Da. |
| Synonyms | Imarikiren |
| CAS number | 1202265-63-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3990145 |
| PubChem | 44554894 |
| ChEMBL | CHEMBL3990145 |














