9XW
~{N}-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-methyl-4-oxidanyl-piperidine-1-carboxamide
Find entries where: 9XW
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | ~{N}-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-methyl-4-oxidanyl-piperidine-1-carboxamide |
| Identifiers | ~{N}-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-methyl-4-oxidanyl-piperidine-1-carboxamide |
| Formula | C19 H26 N4 O4 S |
| Molecular Weight | 406.499 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC1(CCN(CC1)C(=O)Nc2nc3c(ccc(c3s2)N4CCOCC4)OC)O |
| InChI | InChI=1S/C19H26N4O4S/c1-19(25)5-7-23(8-6-19)18(24)21-17-20-15-14(26-2)4-3-13(16(15)28-17)22-9-11-27-12-10-22/h3-4,25H,5-12H2,1-2H3,(H,20,21,24) |
| InChIKey | XNBRWUQWSKXMPW-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 54 |
| Chiral Atom Count | 0 |
| Bond Count | 57 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB12203 |
|---|---|
| Name | Tozadenant |
| Groups | investigational |
| Description | Tozadenant has been investigated for the basic science of Cocaine Dependence. |
| Synonyms | Tozadenant |
| Categories |
|
| CAS number | 870070-55-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2105747 |
| PubChem | 11618368 |
| ChEMBL | CHEMBL2105747 |
