A1H
2-(6-morpholin-4-ylpyrimidin-4-yl)-4-(1,2,3-triazol-1-yl)-1~{H}-pyrazol-3-one
Find entries where: A1H
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 2-(6-morpholin-4-ylpyrimidin-4-yl)-4-(1,2,3-triazol-1-yl)-1~{H}-pyrazol-3-one |
| Identifiers | 2-(6-morpholin-4-ylpyrimidin-4-yl)-4-(1,2,3-triazol-1-yl)-1~{H}-pyrazol-3-one |
| Formula | C13 H14 N8 O2 |
| Molecular Weight | 314.303 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cn(nn1)C2=CNN(C2=O)c3cc(ncn3)N4CCOCC4 |
| InChI | InChI=1S/C13H14N8O2/c22-13-10(20-2-1-16-18-20)8-17-21(13)12-7-11(14-9-15-12)19-3-5-23-6-4-19/h1-2,7-9,17H,3-6H2 |
| InChIKey | IJMBOKOTALXLKS-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 37 |
| Chiral Atom Count | 0 |
| Bond Count | 40 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB15642 |
|---|---|
| Name | Molidustat |
| Groups | investigational |
| Description | Molidustat is under investigation in clinical trial NCT03350321 (A Study of Molidustat for Correction of Renal Anemia in Non-dialysis Subjects). |
| Synonyms |
|
| CAS number | 1154028-82-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3646118 |
| PubChem | 59603622 |
| ChEMBL | CHEMBL3991036, CHEMBL3646118 |
