B39
[(1S,2S,4R)-4-{4-[(1S)-2,3-dihydro-1H-inden-1-ylamino]-7H-pyrrolo[2,3-d]pyrimidin-7-yl}-2-hydroxycyclopentyl]methyl sulfamate
Find entries where: B39
as a non-polymer is covalently linked to polymer or other heterogen groups 2 entries
Chemical Component Summary | |
|---|---|
| Name | [(1S,2S,4R)-4-{4-[(1S)-2,3-dihydro-1H-inden-1-ylamino]-7H-pyrrolo[2,3-d]pyrimidin-7-yl}-2-hydroxycyclopentyl]methyl sulfamate |
| Identifiers | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxy-cyclopentyl]methyl sulfamate |
| Formula | C21 H25 N5 O4 S |
| Molecular Weight | 443.519 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1ccc2c(c1)CC[C@@H]2Nc3c4ccn(c4ncn3)[C@@H]5C[C@H]([C@H](C5)O)COS(=O)(=O)N |
| InChI | InChI=1S/C21H25N5O4S/c22-31(28,29)30-11-14-9-15(10-19(14)27)26-8-7-17-20(23-12-24-21(17)26)25-18-6-5-13-3-1-2-4-16(13)18/h1-4,7-8,12,14-15,18-19,27H,5-6,9-11H2,(H2,22,28,29)(H,23,24,25)/t14-,15+,18-,19-/m0/s1 |
| InChIKey | MPUQHZXIXSTTDU-QXGSTGNESA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 4 |
| Bond Count | 60 |
| Aromatic Bond Count | 16 |
Drug Info: DrugBank
| DrugBank ID | DB11759 |
|---|---|
| Name | Pevonedistat |
| Groups | investigational |
| Description | Pevonedistat has been used in trials studying the treatment of Lymphoma, Solid Tumors, Multiple Myeloma, Hodgkin Lymphoma, and Metastatic Melanoma, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 905579-51-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL1231160 |
| PubChem | 16720766 |
| ChEMBL | CHEMBL1231160 |
| ChEBI | CHEBI:95028, CHEBI:145535 |
