BUH
~{N}-[6-[(3~{R},6~{R})-5-azanyl-3,6-dimethyl-6-(trifluoromethyl)-2~{H}-1,4-oxazin-3-yl]-5-fluoranyl-pyridin-2-yl]-3-chloranyl-5-(trifluoromethyl)pyridine-2-carboxamide
| Created: | 2017-10-13 |
| Last modified: | 2018-09-19 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 49 |
| Chiral Atom Count | 2 |
| Bond Count | 51 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | ~{N}-[6-[(3~{R},6~{R})-5-azanyl-3,6-dimethyl-6-(trifluoromethyl)-2~{H}-1,4-oxazin-3-yl]-5-fluoranyl-pyridin-2-yl]-3-chloranyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| Systematic Name (OpenEye OEToolkits) | ~{N}-[6-[(3~{R},6~{R})-5-azanyl-3,6-dimethyl-6-(trifluoromethyl)-2~{H}-1,4-oxazin-3-yl]-5-fluoranyl-pyridin-2-yl]-3-chloranyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| Formula | C19 H15 Cl F7 N5 O2 |
| Molecular Weight | 513.797 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | C[C]1(CO[C](C)(C(=N1)N)C(F)(F)F)c2nc(NC(=O)c3ncc(cc3Cl)C(F)(F)F)ccc2F |
| SMILES | OpenEye OEToolkits | 2.0.6 | CC1(COC(C(=N1)N)(C)C(F)(F)F)c2c(ccc(n2)NC(=O)c3c(cc(cn3)C(F)(F)F)Cl)F |
| Canonical SMILES | CACTVS | 3.385 | C[C@]1(CO[C@](C)(C(=N1)N)C(F)(F)F)c2nc(NC(=O)c3ncc(cc3Cl)C(F)(F)F)ccc2F |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | C[C@]1(CO[C@@](C(=N1)N)(C)C(F)(F)F)c2c(ccc(n2)NC(=O)c3c(cc(cn3)C(F)(F)F)Cl)F |
| InChI | InChI | 1.03 | InChI=1S/C19H15ClF7N5O2/c1-16(7-34-17(2,15(28)32-16)19(25,26)27)13-10(21)3-4-11(30-13)31-14(33)12-9(20)5-8(6-29-12)18(22,23)24/h3-6H,7H2,1-2H3,(H2,28,32)(H,30,31,33)/t16-,17+/m0/s1 |
| InChIKey | InChI | 1.03 | PSBBWFNMHDUTRH-DLBZAZTESA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB19898 |
|---|---|
| Name | Umibecestat |
| Groups | experimental |
| Description | Umibecestat is a small molecule drug. The usage of the INN stem '-becestat' in the name indicates that Umibecestat is a beta secretase inhibitor. Umibecestat has a monoisotopic molecular weight of 513.08 Da. |
| Synonyms | Umibecestat |
| Categories | Enzyme Inhibitors |
| CAS number | 1387560-01-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3670375 |
| PubChem | 88602735 |
| ChEMBL | CHEMBL3670375 |














