Chemical Component Summary | |
|---|---|
| Name | bicuculline methochloride |
| Identifiers | (6~{R})-6-[(5~{S})-6-methyl-7,8-dihydro-5~{H}-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6~{H}-furo[3,4-g][1,3]benzodioxol-8-one |
| Formula | C20 H17 N O6 |
| Molecular Weight | 367.352 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN1CCc2cc3c(cc2[C@H]1[C@H]4c5ccc6c(c5C(=O)O4)OCO6)OCO3 |
| InChI | InChI=1S/C20H17NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)17(21)18-11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18H,4-5,8-9H2,1H3/t17-,18+/m0/s1 |
| InChIKey | IYGYMKDQCDOMRE-ZWKOTPCHSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 44 |
| Chiral Atom Count | 2 |
| Bond Count | 49 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB11562 |
|---|---|
| Name | Bicuculline |
| Groups | experimental |
| Description | Bicuculline is a light-sensitive competitive antagonist of GABAA receptors. It was originally identified in 1932 in plant alkaloid extracts and has been isolated from Dicentra cucullaria, Adlumia fungosa, Fumariaceae, and several Corydalis species. |
| Synonyms |
|
| Categories |
|
| CAS number | 485-49-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 10237 |
| ChEMBL | CHEMBL417990 |
| ChEBI | CHEBI:3092 |
