OD3
1,3-thiazolidine-2,4-dione
| Created: | 2023-01-31 |
| Last modified: | 2023-07-12 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 10 |
| Chiral Atom Count | 0 |
| Bond Count | 10 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | 1,3-thiazolidine-2,4-dione |
| Synonyms | 2,4-Thiazolidinedione |
| Systematic Name (OpenEye OEToolkits) | 1,3-thiazolidine-2,4-dione |
| Formula | C3 H3 N O2 S |
| Molecular Weight | 117.126 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | O=C1CSC(=O)N1 |
| SMILES | OpenEye OEToolkits | 2.0.7 | C1C(=O)NC(=O)S1 |
| Canonical SMILES | CACTVS | 3.385 | O=C1CSC(=O)N1 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | C1C(=O)NC(=O)S1 |
| InChI | InChI | 1.06 | InChI=1S/C3H3NO2S/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) |
| InChIKey | InChI | 1.06 | ZOBPZXTWZATXDG-UHFFFAOYSA-N |
Drug Info: DrugBank
| DrugBank ID | DB11898 |
|---|---|
| Name | 2,4-thiazolidinedione |
| Groups | investigational |
| Description | Thiazolidinedione has been investigated for the treatment of Type 2 Diabetes, Diabetes Mellitus, and DIABETES MELLITUS, TYPE 2. |
| Synonyms |
|
| Categories |
|
| CAS number | 2295-31-0 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Peroxisome proliferator-activated receptor gamma | MGETLGDSPIDPESDSFTDTLSANISQEMTMVDTEMPFWPTNFGISSVDL... | unknown | agonist |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 5437 |
| ChEMBL | CHEMBL85398 |
| ChEBI | CHEBI:50992 |
| CCDC/CSD | TAZOLD03, TAZOLD02 |
| COD | 2200040 |
