SD5
5-[2,6-di(morpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine
Find entries where: SD5
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | 5-[2,6-di(morpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
| Identifiers | 5-(2,6-dimorpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| Formula | C18 H21 F3 N6 O2 |
| Molecular Weight | 410.394 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1c(c(cnc1N)c2cc(nc(n2)N3CCOCC3)N4CCOCC4)C(F)(F)F |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)13-9-15(22)23-11-12(13)14-10-16(26-1-5-28-6-2-26)25-17(24-14)27-3-7-29-8-4-27/h9-11H,1-8H2,(H2,22,23) |
| InChIKey | CWHUFRVAEUJCEF-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 50 |
| Chiral Atom Count | 0 |
| Bond Count | 53 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB11666 |
|---|---|
| Name | Buparlisib |
| Groups | investigational |
| Description | Buparlisib has been used in trials studying the treatment and basic science of Lymphoma, Metastases, Lung Cancer, Solid Tumors, and Breast Cancer, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 944396-07-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2017974 |
| PubChem | 16654980 |
| ChEMBL | CHEMBL2017974 |
| ChEBI | CHEBI:71954 |
