W4Y
1-{2-[(propan-2-yl)oxy]ethyl}-2-sulfanylidene-1,2,3,5-tetrahydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
Find entries where: W4Y
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 1-{2-[(propan-2-yl)oxy]ethyl}-2-sulfanylidene-1,2,3,5-tetrahydro-4H-pyrrolo[3,2-d]pyrimidin-4-one |
| Identifiers | 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5~{H}-pyrrolo[3,2-d]pyrimidin-4-one |
| Formula | C11 H15 N3 O2 S |
| Molecular Weight | 253.321 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)OCCN1c2cc[nH]c2C(=O)NC1=S |
| InChI | InChI=1S/C11H15N3O2S/c1-7(2)16-6-5-14-8-3-4-12-9(8)10(15)13-11(14)17/h3-4,7,12H,5-6H2,1-2H3,(H,13,15,17) |
| InChIKey | FVJCUZCRPIMVLB-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 32 |
| Chiral Atom Count | 0 |
| Bond Count | 33 |
| Aromatic Bond Count | 5 |
Drug Info: DrugBank
| DrugBank ID | DB12440 |
|---|---|
| Name | Verdiperstat |
| Groups | investigational |
| Description | Verdiperstat has been used in trials studying the basic science and treatment of Multiple System Atrophy (MSA). |
| Synonyms | Verdiperstat |
| Categories | Pyrimidines |
| CAS number | 890655-80-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4297594 |
| PubChem | 11528958 |
| ChEMBL | CHEMBL4297594 |
