ZIR
N-(3-methylbut-2-en-1-yl)adenosine
Find entries where: ZIR
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | N-(3-methylbut-2-en-1-yl)adenosine |
| Identifiers | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol |
| Formula | C15 H21 N5 O4 |
| Molecular Weight | 335.358 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(=CCNc1c2c(ncn1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)C |
| InChI | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | USVMJSALORZVDV-SDBHATRESA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 45 |
| Chiral Atom Count | 4 |
| Bond Count | 47 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB11933 |
|---|---|
| Name | Riboprine |
| Groups | investigational |
| Description | Ipa has been used in trials studying the treatment of Nausea and Surgical Site Infection. |
| Synonyms |
|
| Brand Names | CitraNatal 90 DHA |
| CAS number | 7724-76-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 24405 |
| ChEMBL | CHEMBL452867 |
| ChEBI | CHEBI:62881 |
